C8H10N6OS2 — CID 168656574
4-(azidomethyl)-1-(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)pyrrolidin-2-one (PubChem CID 168656574) has the molecular formula C8H10N6OS2 and a molecular weight of 270.34 g/mol. Its IUPAC name is 4-(azidomethyl)-1-(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)pyrrolidin-2-one.
| Compound Name | 4-(azidomethyl)-1-(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168656574 |
| Molecular Formula | C8H10N6OS2 |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.04 |
| IUPAC Name | 4-(azidomethyl)-1-(3-methylsulfanyl-1,2,4-thiadiazol-5-yl)pyrrolidin-2-one |
| SMILES | CSc1nsc(N2CC(CN=[N+]=[N-])CC2=O)n1 |
| InChI | InChI=1S/C8H10N6OS2/c1-16-7-11-8(17-12-7)14-4-5(2-6(14)15)3-10-13-9/h5H,2-4H2,1H3 |
| InChIKey | RURBFRCOZOGEHE-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 94.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|