C12H18N6OS — CID 168656017
4-(azidomethyl)-1-(5-pentan-3-yl-1,3,4-thiadiazol-2-yl)pyrrolidin-2-one (PubChem CID 168656017) has the molecular formula C12H18N6OS and a molecular weight of 294.38 g/mol. Its IUPAC name is 4-(azidomethyl)-1-(5-pentan-3-yl-1,3,4-thiadiazol-2-yl)pyrrolidin-2-one.
| Compound Name | 4-(azidomethyl)-1-(5-pentan-3-yl-1,3,4-thiadiazol-2-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168656017 |
| Molecular Formula | C12H18N6OS |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | 4-(azidomethyl)-1-(5-pentan-3-yl-1,3,4-thiadiazol-2-yl)pyrrolidin-2-one |
| SMILES | CCC(CC)c1nnc(N2CC(CN=[N+]=[N-])CC2=O)s1 |
| InChI | InChI=1S/C12H18N6OS/c1-3-9(4-2)11-15-16-12(20-11)18-7-8(5-10(18)19)6-14-17-13/h8-9H,3-7H2,1-2H3 |
| InChIKey | ZKZWPGMZCITKQP-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 94.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|