C9H13N3O2S2 — CID 168662181
1-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-4-(hydroxymethyl)pyrrolidin-2-one (PubChem CID 168662181) has the molecular formula C9H13N3O2S2 and a molecular weight of 259.36 g/mol. Its IUPAC name is 1-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-4-(hydroxymethyl)pyrrolidin-2-one.
| Compound Name | 1-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-4-(hydroxymethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168662181 |
| Molecular Formula | C9H13N3O2S2 |
| Molecular Weight | 259.36 g/mol |
| Exact Mass | 259.04 |
| IUPAC Name | 1-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-4-(hydroxymethyl)pyrrolidin-2-one |
| SMILES | CCSc1nnc(N2CC(CO)CC2=O)s1 |
| InChI | InChI=1S/C9H13N3O2S2/c1-2-15-9-11-10-8(16-9)12-4-6(5-13)3-7(12)14/h6,13H,2-5H2,1H3 |
| InChIKey | BOKOIFIXPDWWBI-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.36 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|