C9H12ClN3OS2 — CID 168687429
4-chloro-1-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)pyrrolidin-2-one (PubChem CID 168687429) has the molecular formula C9H12ClN3OS2 and a molecular weight of 277.80 g/mol. Its IUPAC name is 4-chloro-1-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)pyrrolidin-2-one.
| Compound Name | 4-chloro-1-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168687429 |
| Molecular Formula | C9H12ClN3OS2 |
| Molecular Weight | 277.80 g/mol |
| Exact Mass | 277.01 |
| IUPAC Name | 4-chloro-1-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)pyrrolidin-2-one |
| SMILES | CCCSc1nnc(N2CC(Cl)CC2=O)s1 |
| InChI | InChI=1S/C9H12ClN3OS2/c1-2-3-15-9-12-11-8(16-9)13-5-6(10)4-7(13)14/h6H,2-5H2,1H3 |
| InChIKey | DLOAJLVNFSDYPC-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.80 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|