C8H12N4O3S3 — CID 168717128
1-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-5-oxopyrrolidine-3-sulfonamide (PubChem CID 168717128) has the molecular formula C8H12N4O3S3 and a molecular weight of 308.41 g/mol. Its IUPAC name is 1-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-5-oxopyrrolidine-3-sulfonamide.
| Compound Name | 1-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-5-oxopyrrolidine-3-sulfonamide |
|---|---|
| PubChem CID | 168717128 |
| Molecular Formula | C8H12N4O3S3 |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.01 |
| IUPAC Name | 1-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-5-oxopyrrolidine-3-sulfonamide |
| SMILES | CCSc1nnc(N2CC(S(N)(=O)=O)CC2=O)s1 |
| InChI | InChI=1S/C8H12N4O3S3/c1-2-16-8-11-10-7(17-8)12-4-5(3-6(12)13)18(9,14)15/h5H,2-4H2,1H3,(H2,9,14,15) |
| InChIKey | LZFKUWURDBAEBV-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 106.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|