C10H14ClN3O3S3 — CID 168672780
[5-oxo-1-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)pyrrolidin-3-yl]methanesulfonyl chloride (PubChem CID 168672780) has the molecular formula C10H14ClN3O3S3 and a molecular weight of 355.89 g/mol. Its IUPAC name is [5-oxo-1-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)pyrrolidin-3-yl]methanesulfonyl chloride.
| Compound Name | [5-oxo-1-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)pyrrolidin-3-yl]methanesulfonyl chloride |
|---|---|
| PubChem CID | 168672780 |
| Molecular Formula | C10H14ClN3O3S3 |
| Molecular Weight | 355.89 g/mol |
| Exact Mass | 354.99 |
| IUPAC Name | [5-oxo-1-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)pyrrolidin-3-yl]methanesulfonyl chloride |
| SMILES | CCCSc1nnc(N2CC(CS(=O)(=O)Cl)CC2=O)s1 |
| InChI | InChI=1S/C10H14ClN3O3S3/c1-2-3-18-10-13-12-9(19-10)14-5-7(4-8(14)15)6-20(11,16)17/h7H,2-6H2,1H3 |
| InChIKey | GZWQOPICXKKVEP-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 80.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.89 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|