C9H14N4O3S3 — CID 168680883
[1-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-5-oxopyrrolidin-3-yl]methanesulfonamide (PubChem CID 168680883) has the molecular formula C9H14N4O3S3 and a molecular weight of 322.44 g/mol. Its IUPAC name is [1-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-5-oxopyrrolidin-3-yl]methanesulfonamide.
| Compound Name | [1-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-5-oxopyrrolidin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 168680883 |
| Molecular Formula | C9H14N4O3S3 |
| Molecular Weight | 322.44 g/mol |
| Exact Mass | 322.02 |
| IUPAC Name | [1-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-5-oxopyrrolidin-3-yl]methanesulfonamide |
| SMILES | CCSc1nnc(N2CC(CS(N)(=O)=O)CC2=O)s1 |
| InChI | InChI=1S/C9H14N4O3S3/c1-2-17-9-12-11-8(18-9)13-4-6(3-7(13)14)5-19(10,15)16/h6H,2-5H2,1H3,(H2,10,15,16) |
| InChIKey | ALLCAODHYYJNGJ-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 106.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.44 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|