C11H16FN3O3S2 — CID 168713672
5-oxo-1-(5-pentyl-1,3,4-thiadiazol-2-yl)pyrrolidine-3-sulfonyl fluoride (PubChem CID 168713672) has the molecular formula C11H16FN3O3S2 and a molecular weight of 321.40 g/mol. Its IUPAC name is 5-oxo-1-(5-pentyl-1,3,4-thiadiazol-2-yl)pyrrolidine-3-sulfonyl fluoride.
| Compound Name | 5-oxo-1-(5-pentyl-1,3,4-thiadiazol-2-yl)pyrrolidine-3-sulfonyl fluoride |
|---|---|
| PubChem CID | 168713672 |
| Molecular Formula | C11H16FN3O3S2 |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | 5-oxo-1-(5-pentyl-1,3,4-thiadiazol-2-yl)pyrrolidine-3-sulfonyl fluoride |
| SMILES | CCCCCc1nnc(N2CC(S(=O)(=O)F)CC2=O)s1 |
| InChI | InChI=1S/C11H16FN3O3S2/c1-2-3-4-5-9-13-14-11(19-9)15-7-8(6-10(15)16)20(12,17)18/h8H,2-7H2,1H3 |
| InChIKey | FRXJODXPZGKMFD-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 80.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|