About 1-(5-butyl-1,3,4-thiadiazol-2-yl)-5-oxopyrrolidine-3-sulfonamide
1-(5-butyl-1,3,4-thiadiazol-2-yl)-5-oxopyrrolidine-3-sulfonamide (PubChem CID 168717006) has the molecular formula C10H16N4O3S2
and a molecular weight of 304.40 g/mol. Its IUPAC name is 1-(5-butyl-1,3,4-thiadiazol-2-yl)-5-oxopyrrolidine-3-sulfonamide.
Molecular Properties
| Compound Name | 1-(5-butyl-1,3,4-thiadiazol-2-yl)-5-oxopyrrolidine-3-sulfonamide |
| PubChem CID | 168717006 |
| Molecular Formula | C10H16N4O3S2 |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | 1-(5-butyl-1,3,4-thiadiazol-2-yl)-5-oxopyrrolidine-3-sulfonamide |
| SMILES | CCCCc1nnc(N2CC(S(N)(=O)=O)CC2=O)s1 |
| InChI | InChI=1S/C10H16N4O3S2/c1-2-3-4-8-12-13-10(18-8)14-6-7(5-9(14)15)19(11,16)17/h7H,2-6H2,1H3,(H2,11,16,17) |
| InChIKey | VLCNLHXXXQRZKF-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 106.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.40 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-(5-butyl-1,3,4-thiadiazol-2-yl)-5-oxopyrrolidine-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-butyl-1,3,4-thiadiazol-2-yl)-5-oxopyrrolidine-3-sulfonamide?
The IUPAC name of 1-(5-butyl-1,3,4-thiadiazol-2-yl)-5-oxopyrrolidine-3-sulfonamide (CID 168717006) is 1-(5-butyl-1,3,4-thiadiazol-2-yl)-5-oxopyrrolidine-3-sulfonamide.
What is the SMILES notation for 1-(5-butyl-1,3,4-thiadiazol-2-yl)-5-oxopyrrolidine-3-sulfonamide?
The canonical SMILES for 1-(5-butyl-1,3,4-thiadiazol-2-yl)-5-oxopyrrolidine-3-sulfonamide is CCCCc1nnc(N2CC(S(N)(=O)=O)CC2=O)s1.
What is the InChIKey of 1-(5-butyl-1,3,4-thiadiazol-2-yl)-5-oxopyrrolidine-3-sulfonamide?
The InChIKey is VLCNLHXXXQRZKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N4O3S2/c1-2-3-4-8-12-13-10(18-8)14-6-7(5-9(14)15)19(11,16)17/h7H,2-6H2,1H3,(H2,11,16,17).
What are the key properties of 1-(5-butyl-1,3,4-thiadiazol-2-yl)-5-oxopyrrolidine-3-sulfonamide?
1-(5-butyl-1,3,4-thiadiazol-2-yl)-5-oxopyrrolidine-3-sulfonamide has a molecular weight of 304.40 g/mol, XLogP of 0.27, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-butyl-1,3,4-thiadiazol-2-yl)-5-oxopyrrolidine-3-sulfonamide is sourced from PubChem (CID 168717006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).