C10H16N4O3S2 — CID 168717006
1-(5-butyl-1,3,4-thiadiazol-2-yl)-5-oxopyrrolidine-3-sulfonamide (PubChem CID 168717006) has the molecular formula C10H16N4O3S2 and a molecular weight of 304.40 g/mol. Its IUPAC name is 1-(5-butyl-1,3,4-thiadiazol-2-yl)-5-oxopyrrolidine-3-sulfonamide.
| Compound Name | 1-(5-butyl-1,3,4-thiadiazol-2-yl)-5-oxopyrrolidine-3-sulfonamide |
|---|---|
| PubChem CID | 168717006 |
| Molecular Formula | C10H16N4O3S2 |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | 1-(5-butyl-1,3,4-thiadiazol-2-yl)-5-oxopyrrolidine-3-sulfonamide |
| SMILES | CCCCc1nnc(N2CC(S(N)(=O)=O)CC2=O)s1 |
| InChI | InChI=1S/C10H16N4O3S2/c1-2-3-4-8-12-13-10(18-8)14-6-7(5-9(14)15)19(11,16)17/h7H,2-6H2,1H3,(H2,11,16,17) |
| InChIKey | VLCNLHXXXQRZKF-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 106.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.40 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |