C7H9N3OS3 — CID 168708714
1-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)-4-sulfanylpyrrolidin-2-one (PubChem CID 168708714) has the molecular formula C7H9N3OS3 and a molecular weight of 247.37 g/mol. Its IUPAC name is 1-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)-4-sulfanylpyrrolidin-2-one.
| Compound Name | 1-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)-4-sulfanylpyrrolidin-2-one |
|---|---|
| PubChem CID | 168708714 |
| Molecular Formula | C7H9N3OS3 |
| Molecular Weight | 247.37 g/mol |
| Exact Mass | 246.99 |
| IUPAC Name | 1-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)-4-sulfanylpyrrolidin-2-one |
| SMILES | CSc1nnc(N2CC(S)CC2=O)s1 |
| InChI | InChI=1S/C7H9N3OS3/c1-13-7-9-8-6(14-7)10-3-4(12)2-5(10)11/h4,12H,2-3H2,1H3 |
| InChIKey | SAQTYVSVGRHLGU-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.37 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|