C11H10N2OS2 — CID 168710737
1-(1,3-benzothiazol-2-yl)-4-sulfanylpyrrolidin-2-one (PubChem CID 168710737) has the molecular formula C11H10N2OS2 and a molecular weight of 250.35 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-yl)-4-sulfanylpyrrolidin-2-one.
| Compound Name | 1-(1,3-benzothiazol-2-yl)-4-sulfanylpyrrolidin-2-one |
|---|---|
| PubChem CID | 168710737 |
| Molecular Formula | C11H10N2OS2 |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.02 |
| IUPAC Name | 1-(1,3-benzothiazol-2-yl)-4-sulfanylpyrrolidin-2-one |
| SMILES | O=C1CC(S)CN1c1nc2ccccc2s1 |
| InChI | InChI=1S/C11H10N2OS2/c14-10-5-7(15)6-13(10)11-12-8-3-1-2-4-9(8)16-11/h1-4,7,15H,5-6H2 |
| InChIKey | UXSWOYBUNNMWEJ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 33.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|