C20H23N3O4S — CID 154822246
4-[(3aR,5R,6S,7aS)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carbonyl]-1-(1,3-benzothiazol-2-yl)pyrrolidin-2-one (PubChem CID 154822246) has the molecular formula C20H23N3O4S and a molecular weight of 401.49 g/mol. Its IUPAC name is 4-[(3aR,5R,6S,7aS)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carbonyl]-1-(1,3-benzothiazol-2-yl)pyrrolidin-2-one.
| Compound Name | 4-[(3aR,5R,6S,7aS)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carbonyl]-1-(1,3-benzothiazol-2-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 154822246 |
| Molecular Formula | C20H23N3O4S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 4-[(3aR,5R,6S,7aS)-5,6-dihydroxy-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carbonyl]-1-(1,3-benzothiazol-2-yl)pyrrolidin-2-one |
| SMILES | O=C(C1CC(=O)N(c2nc3ccccc3s2)C1)N1C[C@H]2C[C@H](O)[C@H](O)C[C@H]2C1 |
| InChI | InChI=1S/C20H23N3O4S/c24-15-5-11-8-22(9-12(11)6-16(15)25)19(27)13-7-18(26)23(10-13)20-21-14-3-1-2-4-17(14)28-20/h1-4,11-13,15-16,24-25H,5-10H2/t11-,12+,13?,15+,16- |
| InChIKey | RBPSCSYRXJQCMO-BZBJNESDSA-N |
| XLogP | 1.24 |
| TPSA | 93.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |