C12H9ClN2O2S — CID 94077556
(3R)-1-(1,3-benzothiazol-2-yl)-5-oxopyrrolidine-3-carbonyl chloride (PubChem CID 94077556) has the molecular formula C12H9ClN2O2S and a molecular weight of 280.74 g/mol. Its IUPAC name is (3R)-1-(1,3-benzothiazol-2-yl)-5-oxopyrrolidine-3-carbonyl chloride.
| Compound Name | (3R)-1-(1,3-benzothiazol-2-yl)-5-oxopyrrolidine-3-carbonyl chloride |
|---|---|
| PubChem CID | 94077556 |
| Molecular Formula | C12H9ClN2O2S |
| Molecular Weight | 280.74 g/mol |
| Exact Mass | 280.01 |
| IUPAC Name | (3R)-1-(1,3-benzothiazol-2-yl)-5-oxopyrrolidine-3-carbonyl chloride |
| SMILES | O=C(Cl)[C@@H]1CC(=O)N(c2nc3ccccc3s2)C1 |
| InChI | InChI=1S/C12H9ClN2O2S/c13-11(17)7-5-10(16)15(6-7)12-14-8-3-1-2-4-9(8)18-12/h1-4,7H,5-6H2/t7-/m1/s1 |
| InChIKey | CEPAQZLTMBUVCQ-SSDOTTSWSA-N |
| XLogP | 2.41 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.74 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|