C18H13ClN2O2S — CID 94077666
(3R)-1-[4-(1,3-benzothiazol-2-yl)phenyl]-5-oxopyrrolidine-3-carbonyl chloride (PubChem CID 94077666) has the molecular formula C18H13ClN2O2S and a molecular weight of 356.83 g/mol. Its IUPAC name is (3R)-1-[4-(1,3-benzothiazol-2-yl)phenyl]-5-oxopyrrolidine-3-carbonyl chloride.
| Compound Name | (3R)-1-[4-(1,3-benzothiazol-2-yl)phenyl]-5-oxopyrrolidine-3-carbonyl chloride |
|---|---|
| PubChem CID | 94077666 |
| Molecular Formula | C18H13ClN2O2S |
| Molecular Weight | 356.83 g/mol |
| Exact Mass | 356.04 |
| IUPAC Name | (3R)-1-[4-(1,3-benzothiazol-2-yl)phenyl]-5-oxopyrrolidine-3-carbonyl chloride |
| SMILES | O=C(Cl)[C@@H]1CC(=O)N(c2ccc(-c3nc4ccccc4s3)cc2)C1 |
| InChI | InChI=1S/C18H13ClN2O2S/c19-17(23)12-9-16(22)21(10-12)13-7-5-11(6-8-13)18-20-14-3-1-2-4-15(14)24-18/h1-8,12H,9-10H2/t12-/m1/s1 |
| InChIKey | CQEKBGFDZTTXBU-GFCCVEGCSA-N |
| XLogP | 4.08 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.83 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|