C8H10N2OS2 — CID 168709125
1-(4-methyl-1,3-thiazol-2-yl)-4-sulfanylpyrrolidin-2-one (PubChem CID 168709125) has the molecular formula C8H10N2OS2 and a molecular weight of 214.31 g/mol. Its IUPAC name is 1-(4-methyl-1,3-thiazol-2-yl)-4-sulfanylpyrrolidin-2-one.
| Compound Name | 1-(4-methyl-1,3-thiazol-2-yl)-4-sulfanylpyrrolidin-2-one |
|---|---|
| PubChem CID | 168709125 |
| Molecular Formula | C8H10N2OS2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.02 |
| IUPAC Name | 1-(4-methyl-1,3-thiazol-2-yl)-4-sulfanylpyrrolidin-2-one |
| SMILES | Cc1csc(N2CC(S)CC2=O)n1 |
| InChI | InChI=1S/C8H10N2OS2/c1-5-4-13-8(9-5)10-3-6(12)2-7(10)11/h4,6,12H,2-3H2,1H3 |
| InChIKey | OQDSLIDUVOWBCJ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 33.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|