C8H11N5OS — CID 168657098
4-(azidomethyl)-1-(4,5-dihydro-1,3-thiazol-2-yl)pyrrolidin-2-one (PubChem CID 168657098) has the molecular formula C8H11N5OS and a molecular weight of 225.28 g/mol. Its IUPAC name is 4-(azidomethyl)-1-(4,5-dihydro-1,3-thiazol-2-yl)pyrrolidin-2-one.
| Compound Name | 4-(azidomethyl)-1-(4,5-dihydro-1,3-thiazol-2-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168657098 |
| Molecular Formula | C8H11N5OS |
| Molecular Weight | 225.28 g/mol |
| Exact Mass | 225.07 |
| IUPAC Name | 4-(azidomethyl)-1-(4,5-dihydro-1,3-thiazol-2-yl)pyrrolidin-2-one |
| SMILES | [N-]=[N+]=NCC1CC(=O)N(C2=NCCS2)C1 |
| InChI | InChI=1S/C8H11N5OS/c9-12-11-4-6-3-7(14)13(5-6)8-10-1-2-15-8/h6H,1-5H2 |
| InChIKey | GYVDPXCYZGZKEV-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 81.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.28 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|