C10H12BrN3O2 — CID 168504648
2-[4-(bromomethyl)-2-oxopyrrolidin-1-yl]-4-methyl-1H-pyrimidin-6-one (PubChem CID 168504648) has the molecular formula C10H12BrN3O2 and a molecular weight of 286.13 g/mol. Its IUPAC name is 2-[4-(bromomethyl)-2-oxopyrrolidin-1-yl]-4-methyl-1H-pyrimidin-6-one.
| Compound Name | 2-[4-(bromomethyl)-2-oxopyrrolidin-1-yl]-4-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 168504648 |
| Molecular Formula | C10H12BrN3O2 |
| Molecular Weight | 286.13 g/mol |
| Exact Mass | 285.01 |
| IUPAC Name | 2-[4-(bromomethyl)-2-oxopyrrolidin-1-yl]-4-methyl-1H-pyrimidin-6-one |
| SMILES | Cc1cc(=O)[nH]c(N2CC(CBr)CC2=O)n1 |
| InChI | InChI=1S/C10H12BrN3O2/c1-6-2-8(15)13-10(12-6)14-5-7(4-11)3-9(14)16/h2,7H,3-5H2,1H3,(H,12,13,15) |
| InChIKey | GDKXRWWCOIJYBU-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.13 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|