C13H12BrN3O — CID 168506372
4-(bromomethyl)-1-(1,7-naphthyridin-8-yl)pyrrolidin-2-one (PubChem CID 168506372) has the molecular formula C13H12BrN3O and a molecular weight of 306.16 g/mol. Its IUPAC name is 4-(bromomethyl)-1-(1,7-naphthyridin-8-yl)pyrrolidin-2-one.
| Compound Name | 4-(bromomethyl)-1-(1,7-naphthyridin-8-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168506372 |
| Molecular Formula | C13H12BrN3O |
| Molecular Weight | 306.16 g/mol |
| Exact Mass | 305.02 |
| IUPAC Name | 4-(bromomethyl)-1-(1,7-naphthyridin-8-yl)pyrrolidin-2-one |
| SMILES | O=C1CC(CBr)CN1c1nccc2cccnc12 |
| InChI | InChI=1S/C13H12BrN3O/c14-7-9-6-11(18)17(8-9)13-12-10(3-5-16-13)2-1-4-15-12/h1-5,9H,6-8H2 |
| InChIKey | IMFSTVVGYHCJPC-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.16 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|