C12H10ClN3O3S — CID 168712978
1-(1,7-naphthyridin-8-yl)-5-oxopyrrolidine-3-sulfonyl chloride (PubChem CID 168712978) has the molecular formula C12H10ClN3O3S and a molecular weight of 311.75 g/mol. Its IUPAC name is 1-(1,7-naphthyridin-8-yl)-5-oxopyrrolidine-3-sulfonyl chloride.
| Compound Name | 1-(1,7-naphthyridin-8-yl)-5-oxopyrrolidine-3-sulfonyl chloride |
|---|---|
| PubChem CID | 168712978 |
| Molecular Formula | C12H10ClN3O3S |
| Molecular Weight | 311.75 g/mol |
| Exact Mass | 311.01 |
| IUPAC Name | 1-(1,7-naphthyridin-8-yl)-5-oxopyrrolidine-3-sulfonyl chloride |
| SMILES | O=C1CC(S(=O)(=O)Cl)CN1c1nccc2cccnc12 |
| InChI | InChI=1S/C12H10ClN3O3S/c13-20(18,19)9-6-10(17)16(7-9)12-11-8(3-5-15-12)2-1-4-14-11/h1-5,9H,6-7H2 |
| InChIKey | MBJIGWQMWSWZLB-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 80.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.75 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |