C11H13ClN2O3S — CID 168711290
1-(3-ethyl-2-pyridinyl)-5-oxopyrrolidine-3-sulfonyl chloride (PubChem CID 168711290) has the molecular formula C11H13ClN2O3S and a molecular weight of 288.76 g/mol. Its IUPAC name is 1-(3-ethyl-2-pyridinyl)-5-oxopyrrolidine-3-sulfonyl chloride.
| Compound Name | 1-(3-ethyl-2-pyridinyl)-5-oxopyrrolidine-3-sulfonyl chloride |
|---|---|
| PubChem CID | 168711290 |
| Molecular Formula | C11H13ClN2O3S |
| Molecular Weight | 288.76 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | 1-(3-ethyl-2-pyridinyl)-5-oxopyrrolidine-3-sulfonyl chloride |
| SMILES | CCc1cccnc1N1CC(S(=O)(=O)Cl)CC1=O |
| InChI | InChI=1S/C11H13ClN2O3S/c1-2-8-4-3-5-13-11(8)14-7-9(6-10(14)15)18(12,16)17/h3-5,9H,2,6-7H2,1H3 |
| InChIKey | DDMPZOBEYRPZHD-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.76 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |