C13H14N4O3S — CID 168683370
[1-(1,7-naphthyridin-8-yl)-5-oxopyrrolidin-3-yl]methanesulfonamide (PubChem CID 168683370) has the molecular formula C13H14N4O3S and a molecular weight of 306.35 g/mol. Its IUPAC name is [1-(1,7-naphthyridin-8-yl)-5-oxopyrrolidin-3-yl]methanesulfonamide.
| Compound Name | [1-(1,7-naphthyridin-8-yl)-5-oxopyrrolidin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 168683370 |
| Molecular Formula | C13H14N4O3S |
| Molecular Weight | 306.35 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | [1-(1,7-naphthyridin-8-yl)-5-oxopyrrolidin-3-yl]methanesulfonamide |
| SMILES | NS(=O)(=O)CC1CC(=O)N(c2nccc3cccnc23)C1 |
| InChI | InChI=1S/C13H14N4O3S/c14-21(19,20)8-9-6-11(18)17(7-9)13-12-10(3-5-16-13)2-1-4-15-12/h1-5,9H,6-8H2,(H2,14,19,20) |
| InChIKey | AMCAJXACXAHVJR-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 106.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.35 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |