C15H17N3O3S — CID 168681419
[1-(8-methylquinolin-5-yl)-5-oxopyrrolidin-3-yl]methanesulfonamide (PubChem CID 168681419) has the molecular formula C15H17N3O3S and a molecular weight of 319.39 g/mol. Its IUPAC name is [1-(8-methylquinolin-5-yl)-5-oxopyrrolidin-3-yl]methanesulfonamide.
| Compound Name | [1-(8-methylquinolin-5-yl)-5-oxopyrrolidin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 168681419 |
| Molecular Formula | C15H17N3O3S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | [1-(8-methylquinolin-5-yl)-5-oxopyrrolidin-3-yl]methanesulfonamide |
| SMILES | Cc1ccc(N2CC(CS(N)(=O)=O)CC2=O)c2cccnc12 |
| InChI | InChI=1S/C15H17N3O3S/c1-10-4-5-13(12-3-2-6-17-15(10)12)18-8-11(7-14(18)19)9-22(16,20)21/h2-6,11H,7-9H2,1H3,(H2,16,20,21) |
| InChIKey | CDQPSGISKLULLF-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 93.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |