C10H12BrN3O4S — CID 168682336
[1-(5-bromo-3-hydroxy-2-pyridinyl)-5-oxopyrrolidin-3-yl]methanesulfonamide (PubChem CID 168682336) has the molecular formula C10H12BrN3O4S and a molecular weight of 350.19 g/mol. Its IUPAC name is [1-(5-bromo-3-hydroxy-2-pyridinyl)-5-oxopyrrolidin-3-yl]methanesulfonamide.
| Compound Name | [1-(5-bromo-3-hydroxy-2-pyridinyl)-5-oxopyrrolidin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 168682336 |
| Molecular Formula | C10H12BrN3O4S |
| Molecular Weight | 350.19 g/mol |
| Exact Mass | 348.97 |
| IUPAC Name | [1-(5-bromo-3-hydroxy-2-pyridinyl)-5-oxopyrrolidin-3-yl]methanesulfonamide |
| SMILES | NS(=O)(=O)CC1CC(=O)N(c2ncc(Br)cc2O)C1 |
| InChI | InChI=1S/C10H12BrN3O4S/c11-7-2-8(15)10(13-3-7)14-4-6(1-9(14)16)5-19(12,17)18/h2-3,6,15H,1,4-5H2,(H2,12,17,18) |
| InChIKey | WDAFXWIPPFHHOC-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 113.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.19 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |