C10H11ClIN3O3S — CID 168682856
[1-(5-chloro-3-iodo-2-pyridinyl)-5-oxopyrrolidin-3-yl]methanesulfonamide (PubChem CID 168682856) has the molecular formula C10H11ClIN3O3S and a molecular weight of 415.64 g/mol. Its IUPAC name is [1-(5-chloro-3-iodo-2-pyridinyl)-5-oxopyrrolidin-3-yl]methanesulfonamide.
| Compound Name | [1-(5-chloro-3-iodo-2-pyridinyl)-5-oxopyrrolidin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 168682856 |
| Molecular Formula | C10H11ClIN3O3S |
| Molecular Weight | 415.64 g/mol |
| Exact Mass | 414.93 |
| IUPAC Name | [1-(5-chloro-3-iodo-2-pyridinyl)-5-oxopyrrolidin-3-yl]methanesulfonamide |
| SMILES | NS(=O)(=O)CC1CC(=O)N(c2ncc(Cl)cc2I)C1 |
| InChI | InChI=1S/C10H11ClIN3O3S/c11-7-2-8(12)10(14-3-7)15-4-6(1-9(15)16)5-19(13,17)18/h2-3,6H,1,4-5H2,(H2,13,17,18) |
| InChIKey | WYYJIUVTFGAUOG-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 93.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.64 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|