C10H9ClF2N2O3S — CID 168676808
[1-(5-chloro-3-fluoro-2-pyridinyl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride (PubChem CID 168676808) has the molecular formula C10H9ClF2N2O3S and a molecular weight of 310.71 g/mol. Its IUPAC name is [1-(5-chloro-3-fluoro-2-pyridinyl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride.
| Compound Name | [1-(5-chloro-3-fluoro-2-pyridinyl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
|---|---|
| PubChem CID | 168676808 |
| Molecular Formula | C10H9ClF2N2O3S |
| Molecular Weight | 310.71 g/mol |
| Exact Mass | 310.00 |
| IUPAC Name | [1-(5-chloro-3-fluoro-2-pyridinyl)-5-oxopyrrolidin-3-yl]methanesulfonyl fluoride |
| SMILES | O=C1CC(CS(=O)(=O)F)CN1c1ncc(Cl)cc1F |
| InChI | InChI=1S/C10H9ClF2N2O3S/c11-7-2-8(12)10(14-3-7)15-4-6(1-9(15)16)5-19(13,17)18/h2-3,6H,1,4-5H2 |
| InChIKey | HKINSIFNVGGGQC-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.71 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |