C10H12Br2N4O3S — CID 168682216
[1-(4-amino-2,5-dibromo-3-pyridinyl)-5-oxopyrrolidin-3-yl]methanesulfonamide (PubChem CID 168682216) has the molecular formula C10H12Br2N4O3S and a molecular weight of 428.11 g/mol. Its IUPAC name is [1-(4-amino-2,5-dibromo-3-pyridinyl)-5-oxopyrrolidin-3-yl]methanesulfonamide.
| Compound Name | [1-(4-amino-2,5-dibromo-3-pyridinyl)-5-oxopyrrolidin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 168682216 |
| Molecular Formula | C10H12Br2N4O3S |
| Molecular Weight | 428.11 g/mol |
| Exact Mass | 425.90 |
| IUPAC Name | [1-(4-amino-2,5-dibromo-3-pyridinyl)-5-oxopyrrolidin-3-yl]methanesulfonamide |
| SMILES | Nc1c(Br)cnc(Br)c1N1CC(CS(N)(=O)=O)CC1=O |
| InChI | InChI=1S/C10H12Br2N4O3S/c11-6-2-15-10(12)9(8(6)13)16-3-5(1-7(16)17)4-20(14,18)19/h2,5H,1,3-4H2,(H2,13,15)(H2,14,18,19) |
| InChIKey | QPYAKCLOOLZKCT-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 119.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.11 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|