C10H12N6O2 — CID 168663911
1-(6-amino-7H-purin-2-yl)-4-(hydroxymethyl)pyrrolidin-2-one (PubChem CID 168663911) has the molecular formula C10H12N6O2 and a molecular weight of 248.25 g/mol. Its IUPAC name is 1-(6-amino-7H-purin-2-yl)-4-(hydroxymethyl)pyrrolidin-2-one.
| Compound Name | 1-(6-amino-7H-purin-2-yl)-4-(hydroxymethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168663911 |
| Molecular Formula | C10H12N6O2 |
| Molecular Weight | 248.25 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 1-(6-amino-7H-purin-2-yl)-4-(hydroxymethyl)pyrrolidin-2-one |
| SMILES | Nc1nc(N2CC(CO)CC2=O)nc2nc[nH]c12 |
| InChI | InChI=1S/C10H12N6O2/c11-8-7-9(13-4-12-7)15-10(14-8)16-2-5(3-17)1-6(16)18/h4-5,17H,1-3H2,(H3,11,12,13,14,15) |
| InChIKey | VSKZRXORRIFYSK-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 121.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.25 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |