C12H13ClN6O2 — CID 168509271
1-[4-amino-6-(hydroxymethyl)pteridin-2-yl]-4-(chloromethyl)pyrrolidin-2-one (PubChem CID 168509271) has the molecular formula C12H13ClN6O2 and a molecular weight of 308.73 g/mol. Its IUPAC name is 1-[4-amino-6-(hydroxymethyl)pteridin-2-yl]-4-(chloromethyl)pyrrolidin-2-one.
| Compound Name | 1-[4-amino-6-(hydroxymethyl)pteridin-2-yl]-4-(chloromethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168509271 |
| Molecular Formula | C12H13ClN6O2 |
| Molecular Weight | 308.73 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 1-[4-amino-6-(hydroxymethyl)pteridin-2-yl]-4-(chloromethyl)pyrrolidin-2-one |
| SMILES | Nc1nc(N2CC(CCl)CC2=O)nc2ncc(CO)nc12 |
| InChI | InChI=1S/C12H13ClN6O2/c13-2-6-1-8(21)19(4-6)12-17-10(14)9-11(18-12)15-3-7(5-20)16-9/h3,6,20H,1-2,4-5H2,(H2,14,15,17,18) |
| InChIKey | SGINBDKZJIZJAC-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 118.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.73 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|