C10H13ClN4OS — CID 168507627
1-(6-amino-2-methylsulfanylpyrimidin-4-yl)-4-(chloromethyl)pyrrolidin-2-one (PubChem CID 168507627) has the molecular formula C10H13ClN4OS and a molecular weight of 272.76 g/mol. Its IUPAC name is 1-(6-amino-2-methylsulfanylpyrimidin-4-yl)-4-(chloromethyl)pyrrolidin-2-one.
| Compound Name | 1-(6-amino-2-methylsulfanylpyrimidin-4-yl)-4-(chloromethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168507627 |
| Molecular Formula | C10H13ClN4OS |
| Molecular Weight | 272.76 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | 1-(6-amino-2-methylsulfanylpyrimidin-4-yl)-4-(chloromethyl)pyrrolidin-2-one |
| SMILES | CSc1nc(N)cc(N2CC(CCl)CC2=O)n1 |
| InChI | InChI=1S/C10H13ClN4OS/c1-17-10-13-7(12)3-8(14-10)15-5-6(4-11)2-9(15)16/h3,6H,2,4-5H2,1H3,(H2,12,13,14) |
| InChIKey | FRXFGOSOVJPOBV-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.76 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|