C12H14BrClN2O — CID 168507963
1-(5-bromo-4,6-dimethyl-2-pyridinyl)-4-(chloromethyl)pyrrolidin-2-one (PubChem CID 168507963) has the molecular formula C12H14BrClN2O and a molecular weight of 317.61 g/mol. Its IUPAC name is 1-(5-bromo-4,6-dimethyl-2-pyridinyl)-4-(chloromethyl)pyrrolidin-2-one.
| Compound Name | 1-(5-bromo-4,6-dimethyl-2-pyridinyl)-4-(chloromethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168507963 |
| Molecular Formula | C12H14BrClN2O |
| Molecular Weight | 317.61 g/mol |
| Exact Mass | 316.00 |
| IUPAC Name | 1-(5-bromo-4,6-dimethyl-2-pyridinyl)-4-(chloromethyl)pyrrolidin-2-one |
| SMILES | Cc1cc(N2CC(CCl)CC2=O)nc(C)c1Br |
| InChI | InChI=1S/C12H14BrClN2O/c1-7-3-10(15-8(2)12(7)13)16-6-9(5-14)4-11(16)17/h3,9H,4-6H2,1-2H3 |
| InChIKey | QXLZUHZVYQDEIS-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.61 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|