C10H11Cl2N3O — CID 168508785
1-(2-amino-6-chloro-3-pyridinyl)-4-(chloromethyl)pyrrolidin-2-one (PubChem CID 168508785) has the molecular formula C10H11Cl2N3O and a molecular weight of 260.12 g/mol. Its IUPAC name is 1-(2-amino-6-chloro-3-pyridinyl)-4-(chloromethyl)pyrrolidin-2-one.
| Compound Name | 1-(2-amino-6-chloro-3-pyridinyl)-4-(chloromethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168508785 |
| Molecular Formula | C10H11Cl2N3O |
| Molecular Weight | 260.12 g/mol |
| Exact Mass | 259.03 |
| IUPAC Name | 1-(2-amino-6-chloro-3-pyridinyl)-4-(chloromethyl)pyrrolidin-2-one |
| SMILES | Nc1nc(Cl)ccc1N1CC(CCl)CC1=O |
| InChI | InChI=1S/C10H11Cl2N3O/c11-4-6-3-9(16)15(5-6)7-1-2-8(12)14-10(7)13/h1-2,6H,3-5H2,(H2,13,14) |
| InChIKey | SHCBYPLPSFGFRJ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.12 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|