C9H10Cl2N4O — CID 168509113
1-(5-amino-2-chloropyrimidin-4-yl)-4-(chloromethyl)pyrrolidin-2-one (PubChem CID 168509113) has the molecular formula C9H10Cl2N4O and a molecular weight of 261.11 g/mol. Its IUPAC name is 1-(5-amino-2-chloropyrimidin-4-yl)-4-(chloromethyl)pyrrolidin-2-one.
| Compound Name | 1-(5-amino-2-chloropyrimidin-4-yl)-4-(chloromethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168509113 |
| Molecular Formula | C9H10Cl2N4O |
| Molecular Weight | 261.11 g/mol |
| Exact Mass | 260.02 |
| IUPAC Name | 1-(5-amino-2-chloropyrimidin-4-yl)-4-(chloromethyl)pyrrolidin-2-one |
| SMILES | Nc1cnc(Cl)nc1N1CC(CCl)CC1=O |
| InChI | InChI=1S/C9H10Cl2N4O/c10-2-5-1-7(16)15(4-5)8-6(12)3-13-9(11)14-8/h3,5H,1-2,4,12H2 |
| InChIKey | NZODLLYSJPAAPR-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.11 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|