C10H8Br2Cl2N2O — CID 168509171
4-(chloromethyl)-1-(3,5-dibromo-4-chloro-2-pyridinyl)pyrrolidin-2-one (PubChem CID 168509171) has the molecular formula C10H8Br2Cl2N2O and a molecular weight of 402.90 g/mol. Its IUPAC name is 4-(chloromethyl)-1-(3,5-dibromo-4-chloro-2-pyridinyl)pyrrolidin-2-one.
| Compound Name | 4-(chloromethyl)-1-(3,5-dibromo-4-chloro-2-pyridinyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168509171 |
| Molecular Formula | C10H8Br2Cl2N2O |
| Molecular Weight | 402.90 g/mol |
| Exact Mass | 399.84 |
| IUPAC Name | 4-(chloromethyl)-1-(3,5-dibromo-4-chloro-2-pyridinyl)pyrrolidin-2-one |
| SMILES | O=C1CC(CCl)CN1c1ncc(Br)c(Cl)c1Br |
| InChI | InChI=1S/C10H8Br2Cl2N2O/c11-6-3-15-10(8(12)9(6)14)16-4-5(2-13)1-7(16)17/h3,5H,1-2,4H2 |
| InChIKey | FFQOBHXWNBLFQP-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.90 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|