C11H9BrClF2NO — CID 168508533
1-(2-bromo-3,4-difluorophenyl)-4-(chloromethyl)pyrrolidin-2-one (PubChem CID 168508533) has the molecular formula C11H9BrClF2NO and a molecular weight of 324.55 g/mol. Its IUPAC name is 1-(2-bromo-3,4-difluorophenyl)-4-(chloromethyl)pyrrolidin-2-one.
| Compound Name | 1-(2-bromo-3,4-difluorophenyl)-4-(chloromethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168508533 |
| Molecular Formula | C11H9BrClF2NO |
| Molecular Weight | 324.55 g/mol |
| Exact Mass | 322.95 |
| IUPAC Name | 1-(2-bromo-3,4-difluorophenyl)-4-(chloromethyl)pyrrolidin-2-one |
| SMILES | O=C1CC(CCl)CN1c1ccc(F)c(F)c1Br |
| InChI | InChI=1S/C11H9BrClF2NO/c12-10-8(2-1-7(14)11(10)15)16-5-6(4-13)3-9(16)17/h1-2,6H,3-5H2 |
| InChIKey | SWGVPBOCNAMMFU-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.55 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|