C11H11ClF2N2O — CID 168509375
1-(2-amino-3,5-difluorophenyl)-4-(chloromethyl)pyrrolidin-2-one (PubChem CID 168509375) has the molecular formula C11H11ClF2N2O and a molecular weight of 260.67 g/mol. Its IUPAC name is 1-(2-amino-3,5-difluorophenyl)-4-(chloromethyl)pyrrolidin-2-one.
| Compound Name | 1-(2-amino-3,5-difluorophenyl)-4-(chloromethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168509375 |
| Molecular Formula | C11H11ClF2N2O |
| Molecular Weight | 260.67 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | 1-(2-amino-3,5-difluorophenyl)-4-(chloromethyl)pyrrolidin-2-one |
| SMILES | Nc1c(F)cc(F)cc1N1CC(CCl)CC1=O |
| InChI | InChI=1S/C11H11ClF2N2O/c12-4-6-1-10(17)16(5-6)9-3-7(13)2-8(14)11(9)15/h2-3,6H,1,4-5,15H2 |
| InChIKey | NRSXSFVNXCAYLJ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.67 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|