C13H15ClFNO3 — CID 168507441
4-(chloromethyl)-1-(5-fluoro-2,4-dimethoxyphenyl)pyrrolidin-2-one (PubChem CID 168507441) has the molecular formula C13H15ClFNO3 and a molecular weight of 287.72 g/mol. Its IUPAC name is 4-(chloromethyl)-1-(5-fluoro-2,4-dimethoxyphenyl)pyrrolidin-2-one.
| Compound Name | 4-(chloromethyl)-1-(5-fluoro-2,4-dimethoxyphenyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168507441 |
| Molecular Formula | C13H15ClFNO3 |
| Molecular Weight | 287.72 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 4-(chloromethyl)-1-(5-fluoro-2,4-dimethoxyphenyl)pyrrolidin-2-one |
| SMILES | COc1cc(OC)c(N2CC(CCl)CC2=O)cc1F |
| InChI | InChI=1S/C13H15ClFNO3/c1-18-11-5-12(19-2)10(4-9(11)15)16-7-8(6-14)3-13(16)17/h4-5,8H,3,6-7H2,1-2H3 |
| InChIKey | FNXGSIXGOKVITA-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.72 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|