C12H12ClFN2O6S — CID 168673045
[1-(4-fluoro-2-methoxy-5-nitrophenyl)-5-oxopyrrolidin-3-yl]methanesulfonyl chloride (PubChem CID 168673045) has the molecular formula C12H12ClFN2O6S and a molecular weight of 366.75 g/mol. Its IUPAC name is [1-(4-fluoro-2-methoxy-5-nitrophenyl)-5-oxopyrrolidin-3-yl]methanesulfonyl chloride.
| Compound Name | [1-(4-fluoro-2-methoxy-5-nitrophenyl)-5-oxopyrrolidin-3-yl]methanesulfonyl chloride |
|---|---|
| PubChem CID | 168673045 |
| Molecular Formula | C12H12ClFN2O6S |
| Molecular Weight | 366.75 g/mol |
| Exact Mass | 366.01 |
| IUPAC Name | [1-(4-fluoro-2-methoxy-5-nitrophenyl)-5-oxopyrrolidin-3-yl]methanesulfonyl chloride |
| SMILES | COc1cc(F)c([N+](=O)[O-])cc1N1CC(CS(=O)(=O)Cl)CC1=O |
| InChI | InChI=1S/C12H12ClFN2O6S/c1-22-11-3-8(14)9(16(18)19)4-10(11)15-5-7(2-12(15)17)6-23(13,20)21/h3-4,7H,2,5-6H2,1H3 |
| InChIKey | JBZWKVHPQOSFMA-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.75 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|