C11H12ClN3O6S — CID 168673093
[1-(6-methoxy-3-nitro-2-pyridinyl)-5-oxopyrrolidin-3-yl]methanesulfonyl chloride (PubChem CID 168673093) has the molecular formula C11H12ClN3O6S and a molecular weight of 349.75 g/mol. Its IUPAC name is [1-(6-methoxy-3-nitro-2-pyridinyl)-5-oxopyrrolidin-3-yl]methanesulfonyl chloride.
| Compound Name | [1-(6-methoxy-3-nitro-2-pyridinyl)-5-oxopyrrolidin-3-yl]methanesulfonyl chloride |
|---|---|
| PubChem CID | 168673093 |
| Molecular Formula | C11H12ClN3O6S |
| Molecular Weight | 349.75 g/mol |
| Exact Mass | 349.01 |
| IUPAC Name | [1-(6-methoxy-3-nitro-2-pyridinyl)-5-oxopyrrolidin-3-yl]methanesulfonyl chloride |
| SMILES | COc1ccc([N+](=O)[O-])c(N2CC(CS(=O)(=O)Cl)CC2=O)n1 |
| InChI | InChI=1S/C11H12ClN3O6S/c1-21-9-3-2-8(15(17)18)11(13-9)14-5-7(4-10(14)16)6-22(12,19)20/h2-3,7H,4-6H2,1H3 |
| InChIKey | MYPPKHJKEOLJHU-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 119.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.75 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|