C12H15N7O2 — CID 168661062
1-[4-amino-6-(hydroxymethyl)pteridin-2-yl]-4-(aminomethyl)pyrrolidin-2-one (PubChem CID 168661062) has the molecular formula C12H15N7O2 and a molecular weight of 289.30 g/mol. Its IUPAC name is 1-[4-amino-6-(hydroxymethyl)pteridin-2-yl]-4-(aminomethyl)pyrrolidin-2-one.
| Compound Name | 1-[4-amino-6-(hydroxymethyl)pteridin-2-yl]-4-(aminomethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168661062 |
| Molecular Formula | C12H15N7O2 |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 1-[4-amino-6-(hydroxymethyl)pteridin-2-yl]-4-(aminomethyl)pyrrolidin-2-one |
| SMILES | NCC1CC(=O)N(c2nc(N)c3nc(CO)cnc3n2)C1 |
| InChI | InChI=1S/C12H15N7O2/c13-2-6-1-8(21)19(4-6)12-17-10(14)9-11(18-12)15-3-7(5-20)16-9/h3,6,20H,1-2,4-5,13H2,(H2,14,15,17,18) |
| InChIKey | BBGBCICSIAYLCW-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 144.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |