C11H12N6O2S — CID 168707019
S-[1-(6-amino-7H-purin-2-yl)-5-oxopyrrolidin-3-yl] ethanethioate (PubChem CID 168707019) has the molecular formula C11H12N6O2S and a molecular weight of 292.32 g/mol. Its IUPAC name is S-[1-(6-amino-7H-purin-2-yl)-5-oxopyrrolidin-3-yl] ethanethioate.
| Compound Name | S-[1-(6-amino-7H-purin-2-yl)-5-oxopyrrolidin-3-yl] ethanethioate |
|---|---|
| PubChem CID | 168707019 |
| Molecular Formula | C11H12N6O2S |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | S-[1-(6-amino-7H-purin-2-yl)-5-oxopyrrolidin-3-yl] ethanethioate |
| SMILES | CC(=O)SC1CC(=O)N(c2nc(N)c3[nH]cnc3n2)C1 |
| InChI | InChI=1S/C11H12N6O2S/c1-5(18)20-6-2-7(19)17(3-6)11-15-9(12)8-10(16-11)14-4-13-8/h4,6H,2-3H2,1H3,(H3,12,13,14,15,16) |
| InChIKey | HKDNMEJKDZGRGO-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 117.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|