C10H9Cl2N3O2S — CID 168706955
S-[1-(5,6-dichloropyrimidin-4-yl)-5-oxopyrrolidin-3-yl] ethanethioate (PubChem CID 168706955) has the molecular formula C10H9Cl2N3O2S and a molecular weight of 306.17 g/mol. Its IUPAC name is S-[1-(5,6-dichloropyrimidin-4-yl)-5-oxopyrrolidin-3-yl] ethanethioate.
| Compound Name | S-[1-(5,6-dichloropyrimidin-4-yl)-5-oxopyrrolidin-3-yl] ethanethioate |
|---|---|
| PubChem CID | 168706955 |
| Molecular Formula | C10H9Cl2N3O2S |
| Molecular Weight | 306.17 g/mol |
| Exact Mass | 304.98 |
| IUPAC Name | S-[1-(5,6-dichloropyrimidin-4-yl)-5-oxopyrrolidin-3-yl] ethanethioate |
| SMILES | CC(=O)SC1CC(=O)N(c2ncnc(Cl)c2Cl)C1 |
| InChI | InChI=1S/C10H9Cl2N3O2S/c1-5(16)18-6-2-7(17)15(3-6)10-8(11)9(12)13-4-14-10/h4,6H,2-3H2,1H3 |
| InChIKey | JARIXCOGVYCMDM-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.17 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|