C14H18N4O3S — CID 168707139
S-[1-(6-morpholin-4-ylpyrimidin-4-yl)-5-oxopyrrolidin-3-yl] ethanethioate (PubChem CID 168707139) has the molecular formula C14H18N4O3S and a molecular weight of 322.39 g/mol. Its IUPAC name is S-[1-(6-morpholin-4-ylpyrimidin-4-yl)-5-oxopyrrolidin-3-yl] ethanethioate.
| Compound Name | S-[1-(6-morpholin-4-ylpyrimidin-4-yl)-5-oxopyrrolidin-3-yl] ethanethioate |
|---|---|
| PubChem CID | 168707139 |
| Molecular Formula | C14H18N4O3S |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | S-[1-(6-morpholin-4-ylpyrimidin-4-yl)-5-oxopyrrolidin-3-yl] ethanethioate |
| SMILES | CC(=O)SC1CC(=O)N(c2cc(N3CCOCC3)ncn2)C1 |
| InChI | InChI=1S/C14H18N4O3S/c1-10(19)22-11-6-14(20)18(8-11)13-7-12(15-9-16-13)17-2-4-21-5-3-17/h7,9,11H,2-6,8H2,1H3 |
| InChIKey | PJRMXDRUPVRZCO-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 75.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|