C12H13N5O2S — CID 168705882
S-[1-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)-5-oxopyrrolidin-3-yl] ethanethioate (PubChem CID 168705882) has the molecular formula C12H13N5O2S and a molecular weight of 291.34 g/mol. Its IUPAC name is S-[1-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)-5-oxopyrrolidin-3-yl] ethanethioate.
| Compound Name | S-[1-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)-5-oxopyrrolidin-3-yl] ethanethioate |
|---|---|
| PubChem CID | 168705882 |
| Molecular Formula | C12H13N5O2S |
| Molecular Weight | 291.34 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | S-[1-(1-methylpyrazolo[5,4-d]pyrimidin-4-yl)-5-oxopyrrolidin-3-yl] ethanethioate |
| SMILES | CC(=O)SC1CC(=O)N(c2ncnc3c2cnn3C)C1 |
| InChI | InChI=1S/C12H13N5O2S/c1-7(18)20-8-3-10(19)17(5-8)12-9-4-15-16(2)11(9)13-6-14-12/h4,6,8H,3,5H2,1-2H3 |
| InChIKey | GNJHENKBGJXTCC-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 80.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.34 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|