C11H12N2O4S2 — CID 168705139
methyl 4-(4-acetylsulfanyl-2-oxopyrrolidin-1-yl)-1,3-thiazole-5-carboxylate (PubChem CID 168705139) has the molecular formula C11H12N2O4S2 and a molecular weight of 300.36 g/mol. Its IUPAC name is methyl 4-(4-acetylsulfanyl-2-oxopyrrolidin-1-yl)-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 4-(4-acetylsulfanyl-2-oxopyrrolidin-1-yl)-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 168705139 |
| Molecular Formula | C11H12N2O4S2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.02 |
| IUPAC Name | methyl 4-(4-acetylsulfanyl-2-oxopyrrolidin-1-yl)-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)c1scnc1N1CC(SC(C)=O)CC1=O |
| InChI | InChI=1S/C11H12N2O4S2/c1-6(14)19-7-3-8(15)13(4-7)10-9(11(16)17-2)18-5-12-10/h5,7H,3-4H2,1-2H3 |
| InChIKey | ZXOQJCSIBWAMHZ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|