C10H12N6O — CID 168661465
4-(aminomethyl)-1-(7H-purin-6-yl)pyrrolidin-2-one (PubChem CID 168661465) has the molecular formula C10H12N6O and a molecular weight of 232.25 g/mol. Its IUPAC name is 4-(aminomethyl)-1-(7H-purin-6-yl)pyrrolidin-2-one.
| Compound Name | 4-(aminomethyl)-1-(7H-purin-6-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168661465 |
| Molecular Formula | C10H12N6O |
| Molecular Weight | 232.25 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | 4-(aminomethyl)-1-(7H-purin-6-yl)pyrrolidin-2-one |
| SMILES | NCC1CC(=O)N(c2ncnc3nc[nH]c23)C1 |
| InChI | InChI=1S/C10H12N6O/c11-2-6-1-7(17)16(3-6)10-8-9(13-4-12-8)14-5-15-10/h4-6H,1-3,11H2,(H,12,13,14,15) |
| InChIKey | KAVUBRFEOUGNDP-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 100.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.25 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |