C11H11N5O3 — CID 168695495
methyl 5-oxo-1-(7H-purin-6-yl)pyrrolidine-3-carboxylate (PubChem CID 168695495) has the molecular formula C11H11N5O3 and a molecular weight of 261.24 g/mol. Its IUPAC name is methyl 5-oxo-1-(7H-purin-6-yl)pyrrolidine-3-carboxylate.
| Compound Name | methyl 5-oxo-1-(7H-purin-6-yl)pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 168695495 |
| Molecular Formula | C11H11N5O3 |
| Molecular Weight | 261.24 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | methyl 5-oxo-1-(7H-purin-6-yl)pyrrolidine-3-carboxylate |
| SMILES | COC(=O)C1CC(=O)N(c2ncnc3nc[nH]c23)C1 |
| InChI | InChI=1S/C11H11N5O3/c1-19-11(18)6-2-7(17)16(3-6)10-8-9(13-4-12-8)14-5-15-10/h4-6H,2-3H2,1H3,(H,12,13,14,15) |
| InChIKey | FJLBADSVNNWGIJ-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 101.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.24 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |