C10H12N6O3S — CID 168683385
[5-oxo-1-(7H-purin-6-yl)pyrrolidin-3-yl]methanesulfonamide (PubChem CID 168683385) has the molecular formula C10H12N6O3S and a molecular weight of 296.31 g/mol. Its IUPAC name is [5-oxo-1-(7H-purin-6-yl)pyrrolidin-3-yl]methanesulfonamide.
| Compound Name | [5-oxo-1-(7H-purin-6-yl)pyrrolidin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 168683385 |
| Molecular Formula | C10H12N6O3S |
| Molecular Weight | 296.31 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | [5-oxo-1-(7H-purin-6-yl)pyrrolidin-3-yl]methanesulfonamide |
| SMILES | NS(=O)(=O)CC1CC(=O)N(c2ncnc3nc[nH]c23)C1 |
| InChI | InChI=1S/C10H12N6O3S/c11-20(18,19)3-6-1-7(17)16(2-6)10-8-9(13-4-12-8)14-5-15-10/h4-6H,1-3H2,(H2,11,18,19)(H,12,13,14,15) |
| InChIKey | KSZXNZJTHHTRAH-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 134.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.31 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |