C10H9N5O3 — CID 168692424
5-oxo-1-(7H-purin-6-yl)pyrrolidine-3-carboxylic acid (PubChem CID 168692424) has the molecular formula C10H9N5O3 and a molecular weight of 247.21 g/mol. Its IUPAC name is 5-oxo-1-(7H-purin-6-yl)pyrrolidine-3-carboxylic acid.
| Compound Name | 5-oxo-1-(7H-purin-6-yl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 168692424 |
| Molecular Formula | C10H9N5O3 |
| Molecular Weight | 247.21 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | 5-oxo-1-(7H-purin-6-yl)pyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)C1CC(=O)N(c2ncnc3nc[nH]c23)C1 |
| InChI | InChI=1S/C10H9N5O3/c16-6-1-5(10(17)18)2-15(6)9-7-8(12-3-11-7)13-4-14-9/h3-5H,1-2H2,(H,17,18)(H,11,12,13,14) |
| InChIKey | MFOJAYMKMXBKOC-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 112.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.21 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |