C11H15N5O — CID 756697
(2S,6R)-2,6-dimethyl-4-(7H-purin-6-yl)morpholine (PubChem CID 756697) has the molecular formula C11H15N5O and a molecular weight of 233.28 g/mol. Its IUPAC name is (2S,6R)-2,6-dimethyl-4-(7H-purin-6-yl)morpholine.
| Compound Name | (2S,6R)-2,6-dimethyl-4-(7H-purin-6-yl)morpholine |
|---|---|
| PubChem CID | 756697 |
| Molecular Formula | C11H15N5O |
| Molecular Weight | 233.28 g/mol |
| Exact Mass | 233.13 |
| IUPAC Name | (2S,6R)-2,6-dimethyl-4-(7H-purin-6-yl)morpholine |
| SMILES | C[C@@H]1CN(c2ncnc3nc[nH]c23)C[C@H](C)O1 |
| InChI | InChI=1S/C11H15N5O/c1-7-3-16(4-8(2)17-7)11-9-10(13-5-12-9)14-6-15-11/h5-8H,3-4H2,1-2H3,(H,12,13,14,15)/t7-,8+ |
| InChIKey | IIHBCXMAJDUMFA-OCAPTIKFSA-N |
| XLogP | 0.97 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.28 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |