C13H14N6O4 — CID 154910539
(3aR,6aS)-2-methyl-5-(7H-purin-6-yl)-3a,4,6,6a-tetrahydropyrrolo[3,4-c]pyrrole-1,3-dione;formic acid (PubChem CID 154910539) has the molecular formula C13H14N6O4 and a molecular weight of 318.29 g/mol. Its IUPAC name is (3aR,6aS)-2-methyl-5-(7H-purin-6-yl)-3a,4,6,6a-tetrahydropyrrolo[3,4-c]pyrrole-1,3-dione;formic acid.
| Compound Name | (3aR,6aS)-2-methyl-5-(7H-purin-6-yl)-3a,4,6,6a-tetrahydropyrrolo[3,4-c]pyrrole-1,3-dione;formic acid |
|---|---|
| PubChem CID | 154910539 |
| Molecular Formula | C13H14N6O4 |
| Molecular Weight | 318.29 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | (3aR,6aS)-2-methyl-5-(7H-purin-6-yl)-3a,4,6,6a-tetrahydropyrrolo[3,4-c]pyrrole-1,3-dione;formic acid |
| SMILES | CN1C(=O)[C@H]2CN(c3ncnc4nc[nH]c34)C[C@H]2C1=O.O=CO |
| InChI | InChI=1S/C12H12N6O2.CH2O2/c1-17-11(19)6-2-18(3-7(6)12(17)20)10-8-9(14-4-13-8)15-5-16-10;2-1-3/h4-7H,2-3H2,1H3,(H,13,14,15,16);1H,(H,2,3)/t6-,7+; |
| InChIKey | YBMCPPNWBPOLHR-UKMDXRBESA-N |
| XLogP | -0.90 |
| TPSA | 132.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.29 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|